C14H17BrO2 — CID 82308149
(E)-5-(4-bromophenyl)-6-methylhept-4-enoic acid (PubChem CID 82308149) has the molecular formula C14H17BrO2 and a molecular weight of 297.19 g/mol. Its IUPAC name is (E)-5-(4-bromophenyl)-6-methylhept-4-enoic acid.
| Compound Name | (E)-5-(4-bromophenyl)-6-methylhept-4-enoic acid |
|---|---|
| PubChem CID | 82308149 |
| Molecular Formula | C14H17BrO2 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | (E)-5-(4-bromophenyl)-6-methylhept-4-enoic acid |
| SMILES | CC(C)/C(=C\CCC(=O)O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H17BrO2/c1-10(2)13(4-3-5-14(16)17)11-6-8-12(15)9-7-11/h4,6-10H,3,5H2,1-2H3,(H,16,17)/b13-4+ |
| InChIKey | QTZDYACFDXXSIL-YIXHJXPBSA-N |
| XLogP | 4.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |