C18H25BrN2O2 — CID 110609771
(E)-N-(4-acetamidobutyl)-3-(4-bromophenyl)-4-methylpent-2-enamide (PubChem CID 110609771) has the molecular formula C18H25BrN2O2 and a molecular weight of 381.31 g/mol. Its IUPAC name is (E)-N-(4-acetamidobutyl)-3-(4-bromophenyl)-4-methylpent-2-enamide.
| Compound Name | (E)-N-(4-acetamidobutyl)-3-(4-bromophenyl)-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 110609771 |
| Molecular Formula | C18H25BrN2O2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (E)-N-(4-acetamidobutyl)-3-(4-bromophenyl)-4-methylpent-2-enamide |
| SMILES | CC(=O)NCCCCNC(=O)/C=C(/c1ccc(Br)cc1)C(C)C |
| InChI | InChI=1S/C18H25BrN2O2/c1-13(2)17(15-6-8-16(19)9-7-15)12-18(23)21-11-5-4-10-20-14(3)22/h6-9,12-13H,4-5,10-11H2,1-3H3,(H,20,22)(H,21,23)/b17-12+ |
| InChIKey | MXJJPQJMEHSIME-SFQUDFHCSA-N |
| XLogP | 3.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|