C21H23NO2 — CID 102035558
N-(3,3-diphenylprop-2-enyl)-N-ethyl-3-oxobutanamide (PubChem CID 102035558) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-(3,3-diphenylprop-2-enyl)-N-ethyl-3-oxobutanamide.
| Compound Name | N-(3,3-diphenylprop-2-enyl)-N-ethyl-3-oxobutanamide |
|---|---|
| PubChem CID | 102035558 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-(3,3-diphenylprop-2-enyl)-N-ethyl-3-oxobutanamide |
| SMILES | CCN(CC=C(c1ccccc1)c1ccccc1)C(=O)CC(C)=O |
| InChI | InChI=1S/C21H23NO2/c1-3-22(21(24)16-17(2)23)15-14-20(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-14H,3,15-16H2,1-2H3 |
| InChIKey | BLIADVMKBCFVIC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|