C20H28O2 — CID 102475400
cis-ethyl (1R,2S)-2-[(E)-oct-1-enyl]-2-phenylcyclopropane-1-carboxylate (PubChem CID 102475400) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-[(E)-oct-1-enyl]-2-phenylcyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2S)-2-[(E)-oct-1-enyl]-2-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102475400 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | cis-ethyl (1R,2S)-2-[(E)-oct-1-enyl]-2-phenylcyclopropane-1-carboxylate |
| SMILES | CCCCCC/C=C/[C@@]1(c2ccccc2)C[C@H]1C(=O)OCC |
| InChI | InChI=1S/C20H28O2/c1-3-5-6-7-8-12-15-20(17-13-10-9-11-14-17)16-18(20)19(21)22-4-2/h9-15,18H,3-8,16H2,1-2H3/b15-12+/t18-,20-/m0/s1 |
| InChIKey | ILFNCFXJXSCPPX-KXXLANPWSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|