C32H51NO3 — CID 70387140
ethyl 1-[(Z)-octadec-9-enoyl]-4-phenylpiperidine-4-carboxylate (PubChem CID 70387140) has the molecular formula C32H51NO3 and a molecular weight of 497.76 g/mol. Its IUPAC name is ethyl 1-[(Z)-octadec-9-enoyl]-4-phenylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-[(Z)-octadec-9-enoyl]-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 70387140 |
| Molecular Formula | C32H51NO3 |
| Molecular Weight | 497.76 g/mol |
| Exact Mass | 497.39 |
| IUPAC Name | ethyl 1-[(Z)-octadec-9-enoyl]-4-phenylpiperidine-4-carboxylate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N1CCC(C(=O)OCC)(c2ccccc2)CC1 |
| InChI | InChI=1S/C32H51NO3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-30(34)33-27-25-32(26-28-33,31(35)36-4-2)29-22-19-18-20-23-29/h11-12,18-20,22-23H,3-10,13-17,21,24-28H2,1-2H3/b12-11- |
| InChIKey | YTHGNHRXCNBPGO-QXMHVHEDSA-N |
| XLogP | 8.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.76 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|