C13H24O2 — CID 102020755
cis-ethyl (1S,2S)-2-hexyl-2-methylcyclopropane-1-carboxylate (PubChem CID 102020755) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is cis-ethyl (1S,2S)-2-hexyl-2-methylcyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1S,2S)-2-hexyl-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102020755 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | cis-ethyl (1S,2S)-2-hexyl-2-methylcyclopropane-1-carboxylate |
| SMILES | CCCCCC[C@@]1(C)C[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C13H24O2/c1-4-6-7-8-9-13(3)10-11(13)12(14)15-5-2/h11H,4-10H2,1-3H3/t11-,13+/m1/s1 |
| InChIKey | HBPYIWSKNHFHIE-YPMHNXCESA-N |
| XLogP | 3.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|