C18H31NO5 — CID 129278282
tert-butyl 4-[(2-ethoxycarbonyl-1-methylcyclopropyl)methoxy]piperidine-1-carboxylate (PubChem CID 129278282) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is tert-butyl 4-[(2-ethoxycarbonyl-1-methylcyclopropyl)methoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-ethoxycarbonyl-1-methylcyclopropyl)methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 129278282 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | tert-butyl 4-[(2-ethoxycarbonyl-1-methylcyclopropyl)methoxy]piperidine-1-carboxylate |
| SMILES | CCOC(=O)C1CC1(C)COC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H31NO5/c1-6-22-15(20)14-11-18(14,5)12-23-13-7-9-19(10-8-13)16(21)24-17(2,3)4/h13-14H,6-12H2,1-5H3 |
| InChIKey | USAFEGLUSUWGME-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |