C8H8Cl2O4 — CID 129386310
ethyl (1S)-2,2-dicarbonochloridoylcyclopropane-1-carboxylate (PubChem CID 129386310) has the molecular formula C8H8Cl2O4 and a molecular weight of 239.05 g/mol. Its IUPAC name is ethyl (1S)-2,2-dicarbonochloridoylcyclopropane-1-carboxylate.
| Compound Name | ethyl (1S)-2,2-dicarbonochloridoylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 129386310 |
| Molecular Formula | C8H8Cl2O4 |
| Molecular Weight | 239.05 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | ethyl (1S)-2,2-dicarbonochloridoylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC1(C(=O)Cl)C(=O)Cl |
| InChI | InChI=1S/C8H8Cl2O4/c1-2-14-5(11)4-3-8(4,6(9)12)7(10)13/h4H,2-3H2,1H3/t4-/m1/s1 |
| InChIKey | CBZKYNFSFHCFCN-SCSAIBSYSA-N |
| XLogP | 1.09 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.05 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|