C16H23O5P — CID 24766722
(3S,4R)-3-diethoxyphosphoryl-5,5-dimethyl-4-phenyloxolan-2-one (PubChem CID 24766722) has the molecular formula C16H23O5P and a molecular weight of 326.33 g/mol. Its IUPAC name is (3S,4R)-3-diethoxyphosphoryl-5,5-dimethyl-4-phenyloxolan-2-one.
| Compound Name | (3S,4R)-3-diethoxyphosphoryl-5,5-dimethyl-4-phenyloxolan-2-one |
|---|---|
| PubChem CID | 24766722 |
| Molecular Formula | C16H23O5P |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (3S,4R)-3-diethoxyphosphoryl-5,5-dimethyl-4-phenyloxolan-2-one |
| SMILES | CCOP(=O)(OCC)[C@@H]1C(=O)OC(C)(C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H23O5P/c1-5-19-22(18,20-6-2)14-13(12-10-8-7-9-11-12)16(3,4)21-15(14)17/h7-11,13-14H,5-6H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | NTAPRHSBRDLTAH-KBPBESRZSA-N |
| XLogP | 3.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|