C14H28O8P2 — CID 15531256
(3S,4S)-3,4-bis(diethoxyphosphoryl)-5,5-dimethyloxolan-2-one (PubChem CID 15531256) has the molecular formula C14H28O8P2 and a molecular weight of 386.32 g/mol. Its IUPAC name is (3S,4S)-3,4-bis(diethoxyphosphoryl)-5,5-dimethyloxolan-2-one.
| Compound Name | (3S,4S)-3,4-bis(diethoxyphosphoryl)-5,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 15531256 |
| Molecular Formula | C14H28O8P2 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (3S,4S)-3,4-bis(diethoxyphosphoryl)-5,5-dimethyloxolan-2-one |
| SMILES | CCOP(=O)(OCC)[C@@H]1[C@@H](P(=O)(OCC)OCC)C(=O)OC1(C)C |
| InChI | InChI=1S/C14H28O8P2/c1-7-18-23(16,19-8-2)11-12(14(5,6)22-13(11)15)24(17,20-9-3)21-10-4/h11-12H,7-10H2,1-6H3/t11-,12-/m1/s1 |
| InChIKey | OLLRYIFNQKULNS-VXGBXAGGSA-N |
| XLogP | 3.59 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|