C9H15IO2 — CID 102355829
(4R)-4-(iodomethyl)-3,3,5,5-tetramethyloxolan-2-one (PubChem CID 102355829) has the molecular formula C9H15IO2 and a molecular weight of 282.12 g/mol. Its IUPAC name is (4R)-4-(iodomethyl)-3,3,5,5-tetramethyloxolan-2-one.
| Compound Name | (4R)-4-(iodomethyl)-3,3,5,5-tetramethyloxolan-2-one |
|---|---|
| PubChem CID | 102355829 |
| Molecular Formula | C9H15IO2 |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | (4R)-4-(iodomethyl)-3,3,5,5-tetramethyloxolan-2-one |
| SMILES | CC1(C)OC(=O)C(C)(C)[C@H]1CI |
| InChI | InChI=1S/C9H15IO2/c1-8(2)6(5-10)9(3,4)12-7(8)11/h6H,5H2,1-4H3/t6-/m1/s1 |
| InChIKey | WJQQOCUWJNKAQO-ZCFIWIBFSA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|