C8H14O2S — CID 139877740
2,4-dimethyl-2-propyl-1,3-oxathiolan-5-one (PubChem CID 139877740) has the molecular formula C8H14O2S and a molecular weight of 174.26 g/mol. Its IUPAC name is 2,4-dimethyl-2-propyl-1,3-oxathiolan-5-one.
| Compound Name | 2,4-dimethyl-2-propyl-1,3-oxathiolan-5-one |
|---|---|
| PubChem CID | 139877740 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 2,4-dimethyl-2-propyl-1,3-oxathiolan-5-one |
| SMILES | CCCC1(C)OC(=O)C(C)S1 |
| InChI | InChI=1S/C8H14O2S/c1-4-5-8(3)10-7(9)6(2)11-8/h6H,4-5H2,1-3H3 |
| InChIKey | NPCBYOXVZZMSLY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |