C9H16O2S — CID 139877737
2-butyl-2,4-dimethyl-1,3-oxathiolan-5-one (PubChem CID 139877737) has the molecular formula C9H16O2S and a molecular weight of 188.29 g/mol. Its IUPAC name is 2-butyl-2,4-dimethyl-1,3-oxathiolan-5-one.
| Compound Name | 2-butyl-2,4-dimethyl-1,3-oxathiolan-5-one |
|---|---|
| PubChem CID | 139877737 |
| Molecular Formula | C9H16O2S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-butyl-2,4-dimethyl-1,3-oxathiolan-5-one |
| SMILES | CCCCC1(C)OC(=O)C(C)S1 |
| InChI | InChI=1S/C9H16O2S/c1-4-5-6-9(3)11-8(10)7(2)12-9/h7H,4-6H2,1-3H3 |
| InChIKey | GNYSVPXPESRMRL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |