C13H24O2S — CID 139877751
2-ethyl-2-heptyl-4-methyl-1,3-oxathiolan-5-one (PubChem CID 139877751) has the molecular formula C13H24O2S and a molecular weight of 244.40 g/mol. Its IUPAC name is 2-ethyl-2-heptyl-4-methyl-1,3-oxathiolan-5-one.
| Compound Name | 2-ethyl-2-heptyl-4-methyl-1,3-oxathiolan-5-one |
|---|---|
| PubChem CID | 139877751 |
| Molecular Formula | C13H24O2S |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 2-ethyl-2-heptyl-4-methyl-1,3-oxathiolan-5-one |
| SMILES | CCCCCCCC1(CC)OC(=O)C(C)S1 |
| InChI | InChI=1S/C13H24O2S/c1-4-6-7-8-9-10-13(5-2)15-12(14)11(3)16-13/h11H,4-10H2,1-3H3 |
| InChIKey | UVMUTRFYKAMYRN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|