C14H26O2S — CID 11357372
(2R,4R)-2-tert-butyl-4-hexyl-4-methyl-1,3-oxathiolan-5-one (PubChem CID 11357372) has the molecular formula C14H26O2S and a molecular weight of 258.43 g/mol. Its IUPAC name is (2R,4R)-2-tert-butyl-4-hexyl-4-methyl-1,3-oxathiolan-5-one.
| Compound Name | (2R,4R)-2-tert-butyl-4-hexyl-4-methyl-1,3-oxathiolan-5-one |
|---|---|
| PubChem CID | 11357372 |
| Molecular Formula | C14H26O2S |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (2R,4R)-2-tert-butyl-4-hexyl-4-methyl-1,3-oxathiolan-5-one |
| SMILES | CCCCCC[C@@]1(C)S[C@H](C(C)(C)C)OC1=O |
| InChI | InChI=1S/C14H26O2S/c1-6-7-8-9-10-14(5)11(15)16-12(17-14)13(2,3)4/h12H,6-10H2,1-5H3/t12-,14-/m1/s1 |
| InChIKey | VZOQWUWUUHOYDL-TZMCWYRMSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|