C16H28O2S — CID 136502772
(5R)-5-decyl-4-hydroxy-3,5-dimethylthiophen-2-one (PubChem CID 136502772) has the molecular formula C16H28O2S and a molecular weight of 284.46 g/mol. Its IUPAC name is (5R)-5-decyl-4-hydroxy-3,5-dimethylthiophen-2-one.
| Compound Name | (5R)-5-decyl-4-hydroxy-3,5-dimethylthiophen-2-one |
|---|---|
| PubChem CID | 136502772 |
| Molecular Formula | C16H28O2S |
| Molecular Weight | 284.46 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (5R)-5-decyl-4-hydroxy-3,5-dimethylthiophen-2-one |
| SMILES | CCCCCCCCCC[C@@]1(C)SC(=O)C(C)=C1O |
| InChI | InChI=1S/C16H28O2S/c1-4-5-6-7-8-9-10-11-12-16(3)14(17)13(2)15(18)19-16/h17H,4-12H2,1-3H3/t16-/m1/s1 |
| InChIKey | DBAHHMIIZICSCD-MRXNPFEDSA-N |
| XLogP | 5.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|