C34H60O4S2 — CID 158073082
(5S)-5-decyl-4-methoxy-3,5-dimethylthiophen-2-one;(5R)-5-decyl-3,3,5-trimethylthiolane-2,4-dione (PubChem CID 158073082) has the molecular formula C34H60O4S2 and a molecular weight of 596.98 g/mol. Its IUPAC name is (5S)-5-decyl-4-methoxy-3,5-dimethylthiophen-2-one;(5R)-5-decyl-3,3,5-trimethylthiolane-2,4-dione.
| Compound Name | (5S)-5-decyl-4-methoxy-3,5-dimethylthiophen-2-one;(5R)-5-decyl-3,3,5-trimethylthiolane-2,4-dione |
|---|---|
| PubChem CID | 158073082 |
| Molecular Formula | C34H60O4S2 |
| Molecular Weight | 596.98 g/mol |
| Exact Mass | 596.39 |
| IUPAC Name | (5S)-5-decyl-4-methoxy-3,5-dimethylthiophen-2-one;(5R)-5-decyl-3,3,5-trimethylthiolane-2,4-dione |
| SMILES | CCCCCCCCCC[C@@]1(C)SC(=O)C(C)(C)C1=O.CCCCCCCCCC[C@]1(C)SC(=O)C(C)=C1OC |
| InChI | InChI=1S/2C17H30O2S/c1-5-6-7-8-9-10-11-12-13-17(4)14(18)16(2,3)15(19)20-17;1-5-6-7-8-9-10-11-12-13-17(3)15(19-4)14(2)16(18)20-17/h2*5-13H2,1-4H3/t2*17-/m10/s1 |
| InChIKey | FMAUGKWISXMQPR-QAOGLABXSA-N |
| XLogP | 10.61 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.98 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|