C18H32S — CID 142075084
2-decyl-2,3,4-trimethyl-5-methylidenethiophene (PubChem CID 142075084) has the molecular formula C18H32S and a molecular weight of 280.52 g/mol. Its IUPAC name is 2-decyl-2,3,4-trimethyl-5-methylidenethiophene.
| Compound Name | 2-decyl-2,3,4-trimethyl-5-methylidenethiophene |
|---|---|
| PubChem CID | 142075084 |
| Molecular Formula | C18H32S |
| Molecular Weight | 280.52 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-decyl-2,3,4-trimethyl-5-methylidenethiophene |
| SMILES | C=C1SC(C)(CCCCCCCCCC)C(C)=C1C |
| InChI | InChI=1S/C18H32S/c1-6-7-8-9-10-11-12-13-14-18(5)16(3)15(2)17(4)19-18/h4,6-14H2,1-3,5H3 |
| InChIKey | ZNRHKEGYUVLGOL-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.52 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|