C19H30O2S — CID 11738801
5-methyl-5-octyl-3,3-bis(prop-2-enyl)thiolane-2,4-dione (PubChem CID 11738801) has the molecular formula C19H30O2S and a molecular weight of 322.51 g/mol. Its IUPAC name is 5-methyl-5-octyl-3,3-bis(prop-2-enyl)thiolane-2,4-dione.
| Compound Name | 5-methyl-5-octyl-3,3-bis(prop-2-enyl)thiolane-2,4-dione |
|---|---|
| PubChem CID | 11738801 |
| Molecular Formula | C19H30O2S |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 5-methyl-5-octyl-3,3-bis(prop-2-enyl)thiolane-2,4-dione |
| SMILES | C=CCC1(CC=C)C(=O)SC(C)(CCCCCCCC)C1=O |
| InChI | InChI=1S/C19H30O2S/c1-5-8-9-10-11-12-15-18(4)16(20)19(13-6-2,14-7-3)17(21)22-18/h6-7H,2-3,5,8-15H2,1,4H3 |
| InChIKey | AGBIARLSXFYGHC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|