C16H28O2S — CID 91220304
5-decyl-3,5-dimethylthiolane-2,4-dione (PubChem CID 91220304) has the molecular formula C16H28O2S and a molecular weight of 284.46 g/mol. Its IUPAC name is 5-decyl-3,5-dimethylthiolane-2,4-dione.
| Compound Name | 5-decyl-3,5-dimethylthiolane-2,4-dione |
|---|---|
| PubChem CID | 91220304 |
| Molecular Formula | C16H28O2S |
| Molecular Weight | 284.46 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 5-decyl-3,5-dimethylthiolane-2,4-dione |
| SMILES | CCCCCCCCCCC1(C)SC(=O)C(C)C1=O |
| InChI | InChI=1S/C16H28O2S/c1-4-5-6-7-8-9-10-11-12-16(3)14(17)13(2)15(18)19-16/h13H,4-12H2,1-3H3 |
| InChIKey | MFIOMTDDBHTONV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|