C10H16O2S — CID 90795208
5-butyl-3,5-dimethylthiolane-2,4-dione (PubChem CID 90795208) has the molecular formula C10H16O2S and a molecular weight of 200.30 g/mol. Its IUPAC name is 5-butyl-3,5-dimethylthiolane-2,4-dione.
| Compound Name | 5-butyl-3,5-dimethylthiolane-2,4-dione |
|---|---|
| PubChem CID | 90795208 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 5-butyl-3,5-dimethylthiolane-2,4-dione |
| SMILES | CCCCC1(C)SC(=O)C(C)C1=O |
| InChI | InChI=1S/C10H16O2S/c1-4-5-6-10(3)8(11)7(2)9(12)13-10/h7H,4-6H2,1-3H3 |
| InChIKey | QXHRQWXIGFIWDZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|