C12H20OS — CID 59131231
(5R)-5-hexyl-4,5-dimethylthiophen-2-one (PubChem CID 59131231) has the molecular formula C12H20OS and a molecular weight of 212.36 g/mol. Its IUPAC name is (5R)-5-hexyl-4,5-dimethylthiophen-2-one.
| Compound Name | (5R)-5-hexyl-4,5-dimethylthiophen-2-one |
|---|---|
| PubChem CID | 59131231 |
| Molecular Formula | C12H20OS |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (5R)-5-hexyl-4,5-dimethylthiophen-2-one |
| SMILES | CCCCCC[C@@]1(C)SC(=O)C=C1C |
| InChI | InChI=1S/C12H20OS/c1-4-5-6-7-8-12(3)10(2)9-11(13)14-12/h9H,4-8H2,1-3H3/t12-/m1/s1 |
| InChIKey | OORDGHPOMBERJI-GFCCVEGCSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|