C22H28F3NO3S — CID 44545963
2-(2-methyl-2-octyl-5-oxothiophen-3-yl)oxy-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 44545963) has the molecular formula C22H28F3NO3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-(2-methyl-2-octyl-5-oxothiophen-3-yl)oxy-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(2-methyl-2-octyl-5-oxothiophen-3-yl)oxy-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 44545963 |
| Molecular Formula | C22H28F3NO3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-(2-methyl-2-octyl-5-oxothiophen-3-yl)oxy-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCCCCCCCC1(C)SC(=O)C=C1OCC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H28F3NO3S/c1-3-4-5-6-7-10-13-21(2)18(14-20(28)30-21)29-15-19(27)26-17-12-9-8-11-16(17)22(23,24)25/h8-9,11-12,14H,3-7,10,13,15H2,1-2H3,(H,26,27) |
| InChIKey | VUUQCYYOOAUFKZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|