C27H36F3N3O2 — CID 155547152
3-[octyl-[3-oxo-3-[2-(trifluoromethyl)anilino]propyl]amino]-N-phenylpropanamide (PubChem CID 155547152) has the molecular formula C27H36F3N3O2 and a molecular weight of 491.60 g/mol. Its IUPAC name is 3-[octyl-[3-oxo-3-[2-(trifluoromethyl)anilino]propyl]amino]-N-phenylpropanamide.
| Compound Name | 3-[octyl-[3-oxo-3-[2-(trifluoromethyl)anilino]propyl]amino]-N-phenylpropanamide |
|---|---|
| PubChem CID | 155547152 |
| Molecular Formula | C27H36F3N3O2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 3-[octyl-[3-oxo-3-[2-(trifluoromethyl)anilino]propyl]amino]-N-phenylpropanamide |
| SMILES | CCCCCCCCN(CCC(=O)Nc1ccccc1)CCC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C27H36F3N3O2/c1-2-3-4-5-6-12-19-33(20-17-25(34)31-22-13-8-7-9-14-22)21-18-26(35)32-24-16-11-10-15-23(24)27(28,29)30/h7-11,13-16H,2-6,12,17-21H2,1H3,(H,31,34)(H,32,35) |
| InChIKey | HWWSPBADQAJXFE-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|