C25H42N4O2 — CID 78320406
3-[[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-octylamino]-N-phenylpropanamide (PubChem CID 78320406) has the molecular formula C25H42N4O2 and a molecular weight of 430.64 g/mol. Its IUPAC name is 3-[[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-octylamino]-N-phenylpropanamide.
| Compound Name | 3-[[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-octylamino]-N-phenylpropanamide |
|---|---|
| PubChem CID | 78320406 |
| Molecular Formula | C25H42N4O2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | 3-[[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-octylamino]-N-phenylpropanamide |
| SMILES | CCCCCCCCN(CCC(=O)Nc1ccccc1)CCC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C25H42N4O2/c1-3-4-5-6-7-11-16-28(17-14-24(30)26-23-12-9-8-10-13-23)18-15-25(31)29-21-19-27(2)20-22-29/h8-10,12-13H,3-7,11,14-22H2,1-2H3,(H,26,30) |
| InChIKey | YNCKDUDZVVACEJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|