C14H14F3NO3 — CID 8673210
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] (E)-pent-2-enoate (PubChem CID 8673210) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] (E)-pent-2-enoate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] (E)-pent-2-enoate |
|---|---|
| PubChem CID | 8673210 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)OCC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO3/c1-2-3-8-13(20)21-9-12(19)18-11-7-5-4-6-10(11)14(15,16)17/h3-8H,2,9H2,1H3,(H,18,19)/b8-3+ |
| InChIKey | IYVQZWUYHQJKHG-FPYGCLRLSA-N |
| XLogP | 3.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|