C13H13F2NO3 — CID 8673283
[2-(2,5-difluoroanilino)-2-oxoethyl] (E)-pent-2-enoate (PubChem CID 8673283) has the molecular formula C13H13F2NO3 and a molecular weight of 269.25 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] (E)-pent-2-enoate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] (E)-pent-2-enoate |
|---|---|
| PubChem CID | 8673283 |
| Molecular Formula | C13H13F2NO3 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)OCC(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C13H13F2NO3/c1-2-3-4-13(18)19-8-12(17)16-11-7-9(14)5-6-10(11)15/h3-7H,2,8H2,1H3,(H,16,17)/b4-3+ |
| InChIKey | SSXGGCCURRBKOI-ONEGZZNKSA-N |
| XLogP | 2.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|