C22H24F3NO5 — CID 29242975
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 4-butoxy-3-ethoxybenzoate (PubChem CID 29242975) has the molecular formula C22H24F3NO5 and a molecular weight of 439.43 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 4-butoxy-3-ethoxybenzoate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 4-butoxy-3-ethoxybenzoate |
|---|---|
| PubChem CID | 29242975 |
| Molecular Formula | C22H24F3NO5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 4-butoxy-3-ethoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)Nc2ccccc2C(F)(F)F)cc1OCC |
| InChI | InChI=1S/C22H24F3NO5/c1-3-5-12-30-18-11-10-15(13-19(18)29-4-2)21(28)31-14-20(27)26-17-9-7-6-8-16(17)22(23,24)25/h6-11,13H,3-5,12,14H2,1-2H3,(H,26,27) |
| InChIKey | OTHZQONBAMHJKW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|