C26H38N2O3S — CID 90364649
5-methyl-4-[2-[4-(4-methylphenyl)piperazin-1-yl]-2-oxoethoxy]-5-octylthiophen-2-one (PubChem CID 90364649) has the molecular formula C26H38N2O3S and a molecular weight of 458.67 g/mol. Its IUPAC name is 5-methyl-4-[2-[4-(4-methylphenyl)piperazin-1-yl]-2-oxoethoxy]-5-octylthiophen-2-one.
| Compound Name | 5-methyl-4-[2-[4-(4-methylphenyl)piperazin-1-yl]-2-oxoethoxy]-5-octylthiophen-2-one |
|---|---|
| PubChem CID | 90364649 |
| Molecular Formula | C26H38N2O3S |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 5-methyl-4-[2-[4-(4-methylphenyl)piperazin-1-yl]-2-oxoethoxy]-5-octylthiophen-2-one |
| SMILES | CCCCCCCCC1(C)SC(=O)C=C1OCC(=O)N1CCN(c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C26H38N2O3S/c1-4-5-6-7-8-9-14-26(3)23(19-25(30)32-26)31-20-24(29)28-17-15-27(16-18-28)22-12-10-21(2)11-13-22/h10-13,19H,4-9,14-18,20H2,1-3H3 |
| InChIKey | FLCKZSSGAIPUIC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|