C26H38N2O4S — CID 143906707
2-hydroxy-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone;1-octyl-2-thiabicyclo[3.1.0]hex-4-en-3-one (PubChem CID 143906707) has the molecular formula C26H38N2O4S and a molecular weight of 474.67 g/mol. Its IUPAC name is 2-hydroxy-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone;1-octyl-2-thiabicyclo[3.1.0]hex-4-en-3-one.
| Compound Name | 2-hydroxy-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone;1-octyl-2-thiabicyclo[3.1.0]hex-4-en-3-one |
|---|---|
| PubChem CID | 143906707 |
| Molecular Formula | C26H38N2O4S |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 2-hydroxy-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone;1-octyl-2-thiabicyclo[3.1.0]hex-4-en-3-one |
| SMILES | CCCCCCCCC12CC1=CC(=O)S2.COc1ccc(N2CCN(C(=O)CO)CC2)cc1 |
| InChI | InChI=1S/C13H18N2O3.C13H20OS/c1-18-12-4-2-11(3-5-12)14-6-8-15(9-7-14)13(17)10-16;1-2-3-4-5-6-7-8-13-10-11(13)9-12(14)15-13/h2-5,16H,6-10H2,1H3;9H,2-8,10H2,1H3 |
| InChIKey | LICCZEPWUKWHRX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|