C27H42N2O4S — CID 70948757
4-[2-[4-[(4-methoxycyclohexa-2,4-dien-1-yl)methyl]piperazin-1-yl]-2-oxoethoxy]-5-methyl-5-octylthiophen-2-one (PubChem CID 70948757) has the molecular formula C27H42N2O4S and a molecular weight of 490.71 g/mol. Its IUPAC name is 4-[2-[4-[(4-methoxycyclohexa-2,4-dien-1-yl)methyl]piperazin-1-yl]-2-oxoethoxy]-5-methyl-5-octylthiophen-2-one.
| Compound Name | 4-[2-[4-[(4-methoxycyclohexa-2,4-dien-1-yl)methyl]piperazin-1-yl]-2-oxoethoxy]-5-methyl-5-octylthiophen-2-one |
|---|---|
| PubChem CID | 70948757 |
| Molecular Formula | C27H42N2O4S |
| Molecular Weight | 490.71 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 4-[2-[4-[(4-methoxycyclohexa-2,4-dien-1-yl)methyl]piperazin-1-yl]-2-oxoethoxy]-5-methyl-5-octylthiophen-2-one |
| SMILES | CCCCCCCCC1(C)SC(=O)C=C1OCC(=O)N1CCN(CC2C=CC(OC)=CC2)CC1 |
| InChI | InChI=1S/C27H42N2O4S/c1-4-5-6-7-8-9-14-27(2)24(19-26(31)34-27)33-21-25(30)29-17-15-28(16-18-29)20-22-10-12-23(32-3)13-11-22/h10,12-13,19,22H,4-9,11,14-18,20-21H2,1-3H3 |
| InChIKey | FKCNXEODAMQRNR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.71 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|