C22H32N2O3S — CID 46112894
4-(4-methoxyphenyl)-8-octanoyl-1-thia-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 46112894) has the molecular formula C22H32N2O3S and a molecular weight of 404.58 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-8-octanoyl-1-thia-4,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 4-(4-methoxyphenyl)-8-octanoyl-1-thia-4,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 46112894 |
| Molecular Formula | C22H32N2O3S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 4-(4-methoxyphenyl)-8-octanoyl-1-thia-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | CCCCCCCC(=O)N1CCC2(CC1)SCC(=O)N2c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H32N2O3S/c1-3-4-5-6-7-8-20(25)23-15-13-22(14-16-23)24(21(26)17-28-22)18-9-11-19(27-2)12-10-18/h9-12H,3-8,13-17H2,1-2H3 |
| InChIKey | GATDRSCMQHFYRJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|