C22H23ClN2O3S — CID 46112912
8-(2-chloro-2-phenylacetyl)-4-(4-methoxyphenyl)-1-thia-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 46112912) has the molecular formula C22H23ClN2O3S and a molecular weight of 430.96 g/mol. Its IUPAC name is 8-(2-chloro-2-phenylacetyl)-4-(4-methoxyphenyl)-1-thia-4,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-(2-chloro-2-phenylacetyl)-4-(4-methoxyphenyl)-1-thia-4,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 46112912 |
| Molecular Formula | C22H23ClN2O3S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 8-(2-chloro-2-phenylacetyl)-4-(4-methoxyphenyl)-1-thia-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | COc1ccc(N2C(=O)CSC23CCN(C(=O)C(Cl)c2ccccc2)CC3)cc1 |
| InChI | InChI=1S/C22H23ClN2O3S/c1-28-18-9-7-17(8-10-18)25-19(26)15-29-22(25)11-13-24(14-12-22)21(27)20(23)16-5-3-2-4-6-16/h2-10,20H,11-15H2,1H3 |
| InChIKey | NNCOXLNSWQKYQU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|