C20H29NO2S — CID 957256
4-(4-methoxyphenyl)-8-(2-methylbutan-2-yl)-1-thia-4-azaspiro[4.5]decan-3-one (PubChem CID 957256) has the molecular formula C20H29NO2S and a molecular weight of 347.52 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-8-(2-methylbutan-2-yl)-1-thia-4-azaspiro[4.5]decan-3-one.
| Compound Name | 4-(4-methoxyphenyl)-8-(2-methylbutan-2-yl)-1-thia-4-azaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 957256 |
| Molecular Formula | C20H29NO2S |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 4-(4-methoxyphenyl)-8-(2-methylbutan-2-yl)-1-thia-4-azaspiro[4.5]decan-3-one |
| SMILES | CCC(C)(C)C1CCC2(CC1)SCC(=O)N2c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H29NO2S/c1-5-19(2,3)15-10-12-20(13-11-15)21(18(22)14-24-20)16-6-8-17(23-4)9-7-16/h6-9,15H,5,10-14H2,1-4H3 |
| InChIKey | SRADCZJENFGQIR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |