C17H30O2 — CID 100943792
2-decyl-2,4-dimethyl-3H-pyran-6-one (PubChem CID 100943792) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 2-decyl-2,4-dimethyl-3H-pyran-6-one.
| Compound Name | 2-decyl-2,4-dimethyl-3H-pyran-6-one |
|---|---|
| PubChem CID | 100943792 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 2-decyl-2,4-dimethyl-3H-pyran-6-one |
| SMILES | CCCCCCCCCCC1(C)CC(C)=CC(=O)O1 |
| InChI | InChI=1S/C17H30O2/c1-4-5-6-7-8-9-10-11-12-17(3)14-15(2)13-16(18)19-17/h13H,4-12,14H2,1-3H3 |
| InChIKey | XKNYJNDFEPCQJG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|