C20H38O2 — CID 10781290
5,5-diheptyl-4,4-dimethyloxolan-2-one (PubChem CID 10781290) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is 5,5-diheptyl-4,4-dimethyloxolan-2-one.
| Compound Name | 5,5-diheptyl-4,4-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 10781290 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | 5,5-diheptyl-4,4-dimethyloxolan-2-one |
| SMILES | CCCCCCCC1(CCCCCCC)OC(=O)CC1(C)C |
| InChI | InChI=1S/C20H38O2/c1-5-7-9-11-13-15-20(16-14-12-10-8-6-2)19(3,4)17-18(21)22-20/h5-17H2,1-4H3 |
| InChIKey | UDGMPFMODODWEW-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|