C19H28O2S — CID 91237838
5-(3,7-dimethylundeca-2,6,10-trienyl)-3,5-dimethylthiolane-2,4-dione (PubChem CID 91237838) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is 5-(3,7-dimethylundeca-2,6,10-trienyl)-3,5-dimethylthiolane-2,4-dione.
| Compound Name | 5-(3,7-dimethylundeca-2,6,10-trienyl)-3,5-dimethylthiolane-2,4-dione |
|---|---|
| PubChem CID | 91237838 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 5-(3,7-dimethylundeca-2,6,10-trienyl)-3,5-dimethylthiolane-2,4-dione |
| SMILES | C=CCCC(C)=CCCC(C)=CCC1(C)SC(=O)C(C)C1=O |
| InChI | InChI=1S/C19H28O2S/c1-6-7-9-14(2)10-8-11-15(3)12-13-19(5)17(20)16(4)18(21)22-19/h6,10,12,16H,1,7-9,11,13H2,2-5H3 |
| InChIKey | SQAKGCOTFARUGW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|