C11H18OS — CID 142075085
2-butyl-3,4-dimethyl-5-methylidenethiophen-2-ol (PubChem CID 142075085) has the molecular formula C11H18OS and a molecular weight of 198.33 g/mol. Its IUPAC name is 2-butyl-3,4-dimethyl-5-methylidenethiophen-2-ol.
| Compound Name | 2-butyl-3,4-dimethyl-5-methylidenethiophen-2-ol |
|---|---|
| PubChem CID | 142075085 |
| Molecular Formula | C11H18OS |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-butyl-3,4-dimethyl-5-methylidenethiophen-2-ol |
| SMILES | C=C1SC(O)(CCCC)C(C)=C1C |
| InChI | InChI=1S/C11H18OS/c1-5-6-7-11(12)9(3)8(2)10(4)13-11/h12H,4-7H2,1-3H3 |
| InChIKey | XLYJBPVJFBYEMV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |