About 3-butyldithiolan-3-amine
3-butyldithiolan-3-amine (PubChem CID 123163629) has the molecular formula C7H15NS2
and a molecular weight of 177.34 g/mol. Its IUPAC name is 3-butyldithiolan-3-amine.
Molecular Properties
| Compound Name | 3-butyldithiolan-3-amine |
| PubChem CID | 123163629 |
| Molecular Formula | C7H15NS2 |
| Molecular Weight | 177.34 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 3-butyldithiolan-3-amine |
| SMILES | CCCCC1(N)CCSS1 |
| InChI | InChI=1S/C7H15NS2/c1-2-3-4-7(8)5-6-9-10-7/h2-6,8H2,1H3 |
| InChIKey | GULLIFLWUUVIHM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3-butyldithiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyldithiolan-3-amine?
The IUPAC name of 3-butyldithiolan-3-amine (CID 123163629) is 3-butyldithiolan-3-amine.
What is the SMILES notation for 3-butyldithiolan-3-amine?
The canonical SMILES for 3-butyldithiolan-3-amine is CCCCC1(N)CCSS1.
What is the InChIKey of 3-butyldithiolan-3-amine?
The InChIKey is GULLIFLWUUVIHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NS2/c1-2-3-4-7(8)5-6-9-10-7/h2-6,8H2,1H3.
What are the key properties of 3-butyldithiolan-3-amine?
3-butyldithiolan-3-amine has a molecular weight of 177.34 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyldithiolan-3-amine is sourced from PubChem (CID 123163629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).