About butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate
butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate (PubChem CID 91263443) has the molecular formula C14H24O4S2
and a molecular weight of 320.48 g/mol. Its IUPAC name is butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate.
Molecular Properties
| Compound Name | butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate |
| PubChem CID | 91263443 |
| Molecular Formula | C14H24O4S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate |
| SMILES | CCCC(=O)OCOC(=O)CCCCC1(C)CCSS1 |
| InChI | InChI=1S/C14H24O4S2/c1-3-6-12(15)17-11-18-13(16)7-4-5-8-14(2)9-10-19-20-14/h3-11H2,1-2H3 |
| InChIKey | VJVUIRRHFIUREN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate?
The IUPAC name of butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate (CID 91263443) is butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate.
What is the SMILES notation for butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate?
The canonical SMILES for butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate is CCCC(=O)OCOC(=O)CCCCC1(C)CCSS1.
What is the InChIKey of butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate?
The InChIKey is VJVUIRRHFIUREN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O4S2/c1-3-6-12(15)17-11-18-13(16)7-4-5-8-14(2)9-10-19-20-14/h3-11H2,1-2H3.
What are the key properties of butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate?
butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate has a molecular weight of 320.48 g/mol, XLogP of 3.93, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butanoyloxymethyl 5-(3-methyldithiolan-3-yl)pentanoate is sourced from PubChem (CID 91263443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).