C45H54N2O4S2 — CID 121309972
[11-[5-[(3R)-3-methyldithiolan-3-yl]pentanoylcarbamoyl]benzo[b][1]benzazepin-5-yl] (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate (PubChem CID 121309972) has the molecular formula C45H54N2O4S2 and a molecular weight of 751.07 g/mol. Its IUPAC name is [11-[5-[(3R)-3-methyldithiolan-3-yl]pentanoylcarbamoyl]benzo[b][1]benzazepin-5-yl] (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate.
| Compound Name | [11-[5-[(3R)-3-methyldithiolan-3-yl]pentanoylcarbamoyl]benzo[b][1]benzazepin-5-yl] (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate |
|---|---|
| PubChem CID | 121309972 |
| Molecular Formula | C45H54N2O4S2 |
| Molecular Weight | 751.07 g/mol |
| Exact Mass | 750.35 |
| IUPAC Name | [11-[5-[(3R)-3-methyldithiolan-3-yl]pentanoylcarbamoyl]benzo[b][1]benzazepin-5-yl] (3Z,6Z,9Z,12Z,15Z,18Z)-henicosa-3,6,9,12,15,18-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(=O)OC1=Cc2ccccc2N(C(=O)NC(=O)CCCC[C@]2(C)CCSS2)c2ccccc21 |
| InChI | InChI=1S/C45H54N2O4S2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-32-43(49)51-41-36-37-27-21-23-29-39(37)47(40-30-24-22-28-38(40)41)44(50)46-42(48)31-25-26-33-45(2)34-35-52-53-45/h4-5,7-8,10-11,13-14,16-17,19-24,27-30,36H,3,6,9,12,15,18,25-26,31-35H2,1-2H3,(H,46,48,50)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-/t45-/m1/s1 |
| InChIKey | DDEHJPHQUHUMPW-HZAINFTJSA-N |
| XLogP | 12.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.07 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|