C31H40O2 — CID 54413113
[4-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]phenyl] hex-3-enoate (PubChem CID 54413113) has the molecular formula C31H40O2 and a molecular weight of 444.66 g/mol. Its IUPAC name is [4-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]phenyl] hex-3-enoate.
| Compound Name | [4-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]phenyl] hex-3-enoate |
|---|---|
| PubChem CID | 54413113 |
| Molecular Formula | C31H40O2 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | [4-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]phenyl] hex-3-enoate |
| SMILES | CCC=CCC(=O)Oc1ccc(-c2ccc(C34CCC(CCCCC)(CC3)CC4)cc2)cc1 |
| InChI | InChI=1S/C31H40O2/c1-3-5-7-9-29(32)33-28-16-12-26(13-17-28)25-10-14-27(15-11-25)31-22-19-30(20-23-31,21-24-31)18-8-6-4-2/h5,7,10-17H,3-4,6,8-9,18-24H2,1-2H3 |
| InChIKey | VVNLUGPFSMPKNN-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|