C29H42O4 — CID 57243187
[5-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxan-2-yl] hex-3-enoate (PubChem CID 57243187) has the molecular formula C29H42O4 and a molecular weight of 454.65 g/mol. Its IUPAC name is [5-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxan-2-yl] hex-3-enoate.
| Compound Name | [5-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxan-2-yl] hex-3-enoate |
|---|---|
| PubChem CID | 57243187 |
| Molecular Formula | C29H42O4 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | [5-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxan-2-yl] hex-3-enoate |
| SMILES | CCC=CCC(=O)OC1COC(c2ccc(C34CCC(CCCCC)(CC3)CC4)cc2)CO1 |
| InChI | InChI=1S/C29H42O4/c1-3-5-7-9-26(30)33-27-22-31-25(21-32-27)23-10-12-24(13-11-23)29-18-15-28(16-19-29,17-20-29)14-8-6-4-2/h5,7,10-13,25,27H,3-4,6,8-9,14-22H2,1-2H3 |
| InChIKey | DVLIZROSLNUYRC-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|