C30H46O3 — CID 86756405
(2S,5S)-2-[(E)-hept-2-enoxy]-5-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxane (PubChem CID 86756405) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is (2S,5S)-2-[(E)-hept-2-enoxy]-5-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxane.
| Compound Name | (2S,5S)-2-[(E)-hept-2-enoxy]-5-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxane |
|---|---|
| PubChem CID | 86756405 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | (2S,5S)-2-[(E)-hept-2-enoxy]-5-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl]-1,4-dioxane |
| SMILES | CCCC/C=C/CO[C@@H]1CO[C@@H](c2ccc(C34CCC(CCCCC)(CC3)CC4)cc2)CO1 |
| InChI | InChI=1S/C30H46O3/c1-3-5-7-8-10-22-31-28-24-32-27(23-33-28)25-11-13-26(14-12-25)30-19-16-29(17-20-30,18-21-30)15-9-6-4-2/h8,10-14,27-28H,3-7,9,15-24H2,1-2H3/b10-8+/t27-,28+,29?,30?/m1/s1 |
| InChIKey | IRXZPYVGTXROQA-DLRJRWPZSA-N |
| XLogP | 8.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|