C23H34O4 — CID 139860383
(2S,5S)-2-(4-heptoxyphenyl)-5-[(2E,4E)-hexa-2,4-dienoxy]-1,4-dioxane (PubChem CID 139860383) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (2S,5S)-2-(4-heptoxyphenyl)-5-[(2E,4E)-hexa-2,4-dienoxy]-1,4-dioxane.
| Compound Name | (2S,5S)-2-(4-heptoxyphenyl)-5-[(2E,4E)-hexa-2,4-dienoxy]-1,4-dioxane |
|---|---|
| PubChem CID | 139860383 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (2S,5S)-2-(4-heptoxyphenyl)-5-[(2E,4E)-hexa-2,4-dienoxy]-1,4-dioxane |
| SMILES | C/C=C/C=C/CO[C@@H]1CO[C@@H](c2ccc(OCCCCCCC)cc2)CO1 |
| InChI | InChI=1S/C23H34O4/c1-3-5-7-9-11-16-24-21-14-12-20(13-15-21)22-18-27-23(19-26-22)25-17-10-8-6-4-2/h4,6,8,10,12-15,22-23H,3,5,7,9,11,16-19H2,1-2H3/b6-4+,10-8+/t22-,23+/m1/s1 |
| InChIKey | ZPYNQRHMOKPVMP-BTRNLPQISA-N |
| XLogP | 5.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|