C34H46O2 — CID 54499890
[4-[4-(4-heptyl-1-bicyclo[2.2.2]octanyl)phenyl]phenyl] hept-2-enoate (PubChem CID 54499890) has the molecular formula C34H46O2 and a molecular weight of 486.74 g/mol. Its IUPAC name is [4-[4-(4-heptyl-1-bicyclo[2.2.2]octanyl)phenyl]phenyl] hept-2-enoate.
| Compound Name | [4-[4-(4-heptyl-1-bicyclo[2.2.2]octanyl)phenyl]phenyl] hept-2-enoate |
|---|---|
| PubChem CID | 54499890 |
| Molecular Formula | C34H46O2 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | [4-[4-(4-heptyl-1-bicyclo[2.2.2]octanyl)phenyl]phenyl] hept-2-enoate |
| SMILES | CCCCC=CC(=O)Oc1ccc(-c2ccc(C34CCC(CCCCCCC)(CC3)CC4)cc2)cc1 |
| InChI | InChI=1S/C34H46O2/c1-3-5-7-9-11-21-33-22-25-34(26-23-33,27-24-33)30-17-13-28(14-18-30)29-15-19-31(20-16-29)36-32(35)12-10-8-6-4-2/h10,12-20H,3-9,11,21-27H2,1-2H3 |
| InChIKey | YBRNJTGBDAOJEL-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|