C27H34N2O2 — CID 86756387
[2-[4-(4-propyl-1-bicyclo[2.2.2]octanyl)phenyl]pyrimidin-5-yl] (E)-hex-2-enoate (PubChem CID 86756387) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is [2-[4-(4-propyl-1-bicyclo[2.2.2]octanyl)phenyl]pyrimidin-5-yl] (E)-hex-2-enoate.
| Compound Name | [2-[4-(4-propyl-1-bicyclo[2.2.2]octanyl)phenyl]pyrimidin-5-yl] (E)-hex-2-enoate |
|---|---|
| PubChem CID | 86756387 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | [2-[4-(4-propyl-1-bicyclo[2.2.2]octanyl)phenyl]pyrimidin-5-yl] (E)-hex-2-enoate |
| SMILES | CCC/C=C/C(=O)Oc1cnc(-c2ccc(C34CCC(CCC)(CC3)CC4)cc2)nc1 |
| InChI | InChI=1S/C27H34N2O2/c1-3-5-6-7-24(30)31-23-19-28-25(29-20-23)21-8-10-22(11-9-21)27-16-13-26(12-4-2,14-17-27)15-18-27/h6-11,19-20H,3-5,12-18H2,1-2H3/b7-6+ |
| InChIKey | ZOPABAPADCZTMY-VOTSOKGWSA-N |
| XLogP | 6.80 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|