C26H36N2O3 — CID 67635440
[2-[4-(5-propoxypentyl)phenyl]pyrimidin-5-yl] (E)-oct-2-enoate (PubChem CID 67635440) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is [2-[4-(5-propoxypentyl)phenyl]pyrimidin-5-yl] (E)-oct-2-enoate.
| Compound Name | [2-[4-(5-propoxypentyl)phenyl]pyrimidin-5-yl] (E)-oct-2-enoate |
|---|---|
| PubChem CID | 67635440 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | [2-[4-(5-propoxypentyl)phenyl]pyrimidin-5-yl] (E)-oct-2-enoate |
| SMILES | CCCCC/C=C/C(=O)Oc1cnc(-c2ccc(CCCCCOCCC)cc2)nc1 |
| InChI | InChI=1S/C26H36N2O3/c1-3-5-6-7-10-13-25(29)31-24-20-27-26(28-21-24)23-16-14-22(15-17-23)12-9-8-11-19-30-18-4-2/h10,13-17,20-21H,3-9,11-12,18-19H2,1-2H3/b13-10+ |
| InChIKey | YVEWPIKNCGWJTF-JLHYYAGUSA-N |
| XLogP | 6.32 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|