About [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate
[6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate (PubChem CID 19017147) has the molecular formula C29H41NO3
and a molecular weight of 451.65 g/mol. Its IUPAC name is [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate.
Molecular Properties
| Compound Name | [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate |
| PubChem CID | 19017147 |
| Molecular Formula | C29H41NO3 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate |
| SMILES | CCCCC/C=C/CCC(=O)Oc1ccc(-c2ccc(CCCCCOCCC)cc2)nc1 |
| InChI | InChI=1S/C29H41NO3/c1-3-5-6-7-8-9-12-15-29(31)33-27-20-21-28(30-24-27)26-18-16-25(17-19-26)14-11-10-13-23-32-22-4-2/h8-9,16-21,24H,3-7,10-15,22-23H2,1-2H3/b9-8+ |
| InChIKey | HQIGFDLXECFBBL-CMDGGOBGSA-N |
| XLogP | 7.71 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate?
The IUPAC name of [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate (CID 19017147) is [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate.
What is the SMILES notation for [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate?
The canonical SMILES for [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate is CCCCC/C=C/CCC(=O)Oc1ccc(-c2ccc(CCCCCOCCC)cc2)nc1.
What is the InChIKey of [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate?
The InChIKey is HQIGFDLXECFBBL-CMDGGOBGSA-N. The full InChI is InChI=1S/C29H41NO3/c1-3-5-6-7-8-9-12-15-29(31)33-27-20-21-28(30-24-27)26-18-16-25(17-19-26)14-11-10-13-23-32-22-4-2/h8-9,16-21,24H,3-7,10-15,22-23H2,1-2H3/b9-8+.
What are the key properties of [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate?
[6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate has a molecular weight of 451.65 g/mol, XLogP of 7.71, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[4-(5-propoxypentyl)phenyl]-3-pyridinyl] (E)-dec-4-enoate is sourced from PubChem (CID 19017147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).