About [6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate
[6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate (PubChem CID 54303360) has the molecular formula C28H37NO4
and a molecular weight of 451.61 g/mol. Its IUPAC name is [6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate.
Molecular Properties
| Compound Name | [6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate |
| PubChem CID | 54303360 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | [6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate |
| SMILES | CCCCCCC=CCC(=O)Oc1ccc(-c2ccc(CCC(C)OC(=O)CC)cc2)nc1 |
| InChI | InChI=1S/C28H37NO4/c1-4-6-7-8-9-10-11-12-28(31)33-25-19-20-26(29-21-25)24-17-15-23(16-18-24)14-13-22(3)32-27(30)5-2/h10-11,15-22H,4-9,12-14H2,1-3H3 |
| InChIKey | SFUHTRXFOSCWNY-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate?
The IUPAC name of [6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate (CID 54303360) is [6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate.
What is the SMILES notation for [6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate?
The canonical SMILES for [6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate is CCCCCCC=CCC(=O)Oc1ccc(-c2ccc(CCC(C)OC(=O)CC)cc2)nc1.
What is the InChIKey of [6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate?
The InChIKey is SFUHTRXFOSCWNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H37NO4/c1-4-6-7-8-9-10-11-12-28(31)33-25-19-20-26(29-21-25)24-17-15-23(16-18-24)14-13-22(3)32-27(30)5-2/h10-11,15-22H,4-9,12-14H2,1-3H3.
What are the key properties of [6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate?
[6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate has a molecular weight of 451.61 g/mol, XLogP of 6.84, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[4-(3-propanoyloxybutyl)phenyl]-3-pyridinyl] dec-3-enoate is sourced from PubChem (CID 54303360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).